| Pack Size | Availability | Purity | Price | User Price | Quantity |
|---|---|---|---|---|---|
|
Sorry, there is no price information yet |
|||||
| Transport Condition | Room Temperature |
|---|---|
| Storage Temp. | Inert atmosphere,Room Temperature |
| GHS Pictogram | ![]() |
| Hazard category | N/A |
| Biological Activity | |
| Character | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H302-H315-H319-H335 |
| Flash Point | |
| Safety Statements | P261-P305+P351+P338 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Warning |
|---|---|
| InchiKey | AHGKXYJWIFNPNB-TYSVMGFPSA-N |
| Canonical Smiles | Cl.F[C@H]1CNC[C@H](F)C1 |
| Inchi | InChI=1S/C5H9F2N.ClH/c6-4-1-5(7)3-8-2-4;/h4-5,8H,1-3H2;1H/t4-,5-;/m1./s1 |
| Density | |
| MDL No. | MFCD30803927 |
| Water Solubility | |
| Exact Mass | 157.04698 |
| Chirality | |
| GHS | |
| Cas No. | 259110-61-7 |
| Chemical Name | rel-(3R,5R)-3,5-Difluoropiperidine hydrochloride |
| UN No. | N/A |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
Competitive Price
Delivery Speed
Technical Support
Stock Inventory