Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 5mg | 2 -3 weeks | 99% | |
| 10mg | 2 -3 weeks | 99% | |
| 25mg | 2 -3 weeks | 99% | |
| 100mg | 2 -3 weeks | 99% | |
| 250mg | 2 -3 weeks | 99% | |
| 1g | 2 -3 weeks | 99% |
| Transport Condition | 2-8°C |
|---|---|
| Storage Temp. | Inert atmosphere,2-8°C |
| GHS Pictogram |  |
| Hazard category | - |
| Biological Activity | |
| Character | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H302-H315-H319-H335 |
| Flash Point | |
| Safety Statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Warning |
|---|---|
| InchiKey | YHIUPZFKHZTLSH-LXYIGGQGSA-N |
| Canonical Smiles | CCOC1C=CC(CC2C=C(C=CC=2Cl)[C@@]23O[C@](CO2)(CO)[C@@H](O)[C@H](O)[C@H]3O)=CC=1.OC(=O)[C@@H]1CCC(=O)N1 |
| Inchi | InChI=1S/C22H25ClO7.C5H7NO3/c1-2-28-16-6-3-13(4-7-16)9-14-10-15(5-8-17(14)23)22-20(27)18(25)19(26)21(11-24,30-22)12-29-22;7-4-2-1-3(6-4)5(8)9/h3-8,10,18-20,24-27H,2,9,11-12H2,1H3;3H,1-2H2,(H,6,7)(H,8,9)/t18-,19-,20+,21-,22-;3-/m00/s1 |
| Density | |
| MDL No. | MFCD27956909 |
| Water Solubility | |
| Exact Mass | 565.17148 |
| Chirality | |
| GHS | |
| Cas No. | 1210344-83-4 |
| Chemical Name | (S)-5-Oxopyrrolidine-2-Carboxylic Acid Compound With (1S,2S,3S,4R,5S)-5-(4-Chloro-3-(4-Ethoxybenzyl)Phenyl)-1-(Hydroxymethyl)-6,8-Dioxabicyclo[3.2.1]Octane-2,3,4-Triol (1:1) |
| UN No. | - |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
