Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 5g | 2 -3 weeks | 97% (stabilized with K2CO3) | |
| 25g | 2 -3 weeks | 97% (stabilized with K2CO3) | |
| 100g | 2 -3 weeks | 97% (stabilized with K2CO3) | |
| 500g | 2 -3 weeks | 97% (stabilized with K2CO3) |
| Transport Condition | 2-8°C |
|---|---|
| Storage Temp. | Inert atmosphere,2-8°C |
| GHS Pictogram |   |
| Hazard category | 3 |
| Biological Activity | |
| Character | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H302-H225 |
| Flash Point | |
| Safety Statements | P501-P270-P240-P210-P233-P243-P241-P242-P264-P280-P370+P378-P303+P361+P353-P301+P312+P330-P403+P235 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Danger |
|---|---|
| InchiKey | XVRIEWDDMODMGA-UHFFFAOYSA-N |
| Canonical Smiles | CC(=O)CCCCl |
| Inchi | InChI=1S/C5H9ClO/c1-5(7)3-2-4-6/h2-4H2,1H3 |
| Density | |
| MDL No. | MFCD00001008 |
| Water Solubility | |
| Exact Mass | 120.03419 |
| Chirality | |
| GHS | |
| Cas No. | 5891-21-4 |
| Chemical Name | 5-Chloro-2-Pentanone |
| UN No. | 1224 |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
