Popular keywords:
| Pack Size | Availability | Purity | Price | User Price | Quantity |
|---|---|---|---|---|---|
|
Sorry, there is no price information yet |
|||||
| Transport Condition | Store at room temperature, keep dry and cool |
|---|---|
| Storage Temp. | Store at room temperature, keep dry and cool |
| GHS Pictogram |  |
| Hazard category | |
| Biological Activity | |
| Character | white(Solid) |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H319-H335 |
| Flash Point | |
| Safety Statements | P261-P264-P271-P280-P304+P340-P405-P501 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Warning |
|---|---|
| InchiKey | YASYEJJMZJALEJ-UHFFFAOYSA-N |
| Canonical Smiles | O.OC(=O)C(O)(CC(O)=O)CC(O)=O |
| Inchi | InChI=1S/C6H8O7.H2O/c7-3(8)1-6(13,5(11)12)2-4(9)10;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1H2 |
| Density | |
| MDL No. | MFCD00149972 |
| Water Solubility | |
| Exact Mass | 210.03757 |
| Chirality | |
| GHS | |
| Cas No. | 5949-29-1 |
| Chemical Name | Citric acid (monohydrate) |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
Competitive Price
Delivery Speed
Technical Support
Stock Inventory
