Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 1g | 2 -3 weeks | 95%,stabilized with TBC | |
| 5g | 2 -3 weeks | 95%,stabilized with TBC | |
| 25g | 2 -3 weeks | 95%,stabilized with TBC | |
| 100g | 2 -3 weeks | 95%,stabilized with TBC | |
| 500g | 2 -3 weeks | 95%,stabilized with TBC |
| Transport Condition | -20℃ |
|---|---|
| Storage Temp. | -20℃ |
| GHS Pictogram | |
| Hazard category | |
| Biological Activity | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Dangerous Goods | |
| Risk Statements | H319;H335;H400;H315; |
| Flash Point | |
| Safety Statements | |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | |
|---|---|
| InchiKey | SRXJYTZCORKVNA-UHFFFAOYSA-N |
| Canonical Smiles | C=C(Br)C1C=CC=CC=1 |
| Inchi | InChI=1S/C8H7Br/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H2 |
| Density | |
| MDL No. | 0 |
| Water Solubility | |
| Exact Mass | 181.97311 |
| Chirality | |
| GHS | |
| Cas No. | 98-81-7 |
| Chemical Name | α-Bromostyrene |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
