Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 25g | 2 weeks | 99%+,stabilized with 50ppm MEHQ | |
| 100g | 2 weeks | 99%+,stabilized with 50ppm MEHQ | |
| 500g | 2 weeks | 99%+,stabilized with 50ppm MEHQ | |
| 2.5kg | 2 weeks | 99%+,stabilized with 50ppm MEHQ | |
| 10kg | 2 weeks | 99%+,stabilized with 50ppm MEHQ |
| Transport Condition | Store in a cool,dry area. |
|---|---|
| Storage Temp. | Store in a cool,dry area. |
| GHS Pictogram |  |
| Hazard category | - |
| Biological Activity | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Dangerous Goods | |
| Risk Statements | H317;H410;H400;H315; |
| Flash Point | |
| Safety Statements | P261-P273-P280-P302+P352-P304+P340-P305+P351+P338 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Warning |
|---|---|
| InchiKey | GCTPMLUUWLLESL-UHFFFAOYSA-N |
| Canonical Smiles | C=CC(=O)OCC1C=CC=CC=1 |
| Inchi | InChI=1S/C10H10O2/c1-2-10(11)12-8-9-6-4-3-5-7-9/h2-7H,1,8H2 |
| Density | |
| MDL No. | MFCD00048147 |
| Water Solubility | |
| Exact Mass | 162.06808 |
| Chirality | |
| GHS | |
| Cas No. | 2495-35-4 |
| Chemical Name | Benzyl Acrylate |
| UN No. | - |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
