Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 100mg | 2 -3 weeks | 98%,mixture of isomers | |
| 250mg | 2 -3 weeks | 98%,mixture of isomers | |
| 1g | 2 -3 weeks | 98%,mixture of isomers | |
| 5g | 2 -3 weeks | 98%,mixture of isomers | |
| 25g | 2 -3 weeks | 98%,mixture of isomers | |
| 100g | 2 -3 weeks | 98%,mixture of isomers | |
| 500g | 2 -3 weeks | 98%,mixture of isomers |
| Transport Condition | -20℃,Under inert gas. |
|---|---|
| Storage Temp. | -20℃,Under inert gas. |
| GHS Pictogram |  |
| Hazard category | - |
| Biological Activity | |
| Character | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H317;H373;H361;H401;H412;H315;H303; |
| Flash Point | |
| Safety Statements | P280-P422-P305+P351+P338 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Warning |
|---|---|
| InchiKey | FZJUFJKVIYFBSY-UHFFFAOYSA-N |
| Canonical Smiles | CC(C)(C)C1=CC=C(CCC=O)C=C1 |
| Inchi | InChI=1S/C13H18O/c1-13(2,3)12-8-6-11(7-9-12)5-4-10-14/h6-10H,4-5H2,1-3H3 |
| Density | |
| MDL No. | MFCD00169819 |
| Water Solubility | |
| Exact Mass | 190.13577 |
| Chirality | |
| GHS | |
| Cas No. | 18127-01-0 |
| Chemical Name | 3-(4-(Tert-Butyl)Phenyl)Propanal |
| UN No. | - |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
