Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 10g | 2 -3 weeks | 99% (mixture of analogue) | |
| 25g | 2 -3 weeks | 99% (mixture of analogue) | |
| 100g | 2 -3 weeks | 99% (mixture of analogue) | |
| 500g | 2 -3 weeks | 99% (mixture of analogue) | |
| 1kg | 2 -3 weeks | 99% (mixture of analogue) |
| Transport Condition | Room Temperature |
|---|---|
| Storage Temp. | Sealed in dry,Room Temperature |
| GHS Pictogram |    |
| Hazard category | 9 |
| Biological Activity | |
| Character | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H332-H362-H372-H411 |
| Flash Point | |
| Safety Statements | P201-P260-P263-P264-P270-P271-P273-P304+P340+P312-P308+P313-P391-P501 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Danger |
|---|---|
| InchiKey | OJUZRFGUKHQNJX-UHFFFAOYSA-N |
| Canonical Smiles | CC1C=CC(=CC=1)OP(=O)(OC1C=CC=CC=1)OC1C=CC=CC=1 |
| Inchi | InChI=1S/C19H17O4P/c1-16-12-14-19(15-13-16)23-24(20,21-17-8-4-2-5-9-17)22-18-10-6-3-7-11-18/h2-15H,1H3 |
| Density | |
| MDL No. | MFCD00014920 |
| Water Solubility | |
| Exact Mass | 340.08645 |
| Chirality | |
| GHS | |
| Cas No. | 26444-49-5 |
| Chemical Name | Phosphoric Acid Cresyl Diphenyl Ester |
| UN No. | 3082 |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
