Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 250mg | 2 -3 weeks | 95% （stabilized with TBC）+0.2% D&C Violet No.2 | |
| 250mg | 2 -3 weeks | 95% (stabilized with TBC or HQ) | |
| 1g | 2 -3 weeks | 95% （stabilized with TBC）+0.2% D&C Violet No.2 | |
| 1g | 2 -3 weeks | 95% (stabilized with TBC or HQ) | |
| 5g | 2 -3 weeks | 95% （stabilized with TBC）+0.2% D&C Violet No.2 | |
| 5g | 2 -3 weeks | 95% (stabilized with TBC or HQ) | |
| 25g | 2 -3 weeks | 95% （stabilized with TBC）+0.2% D&C Violet No.2 | |
| 25g | 2 -3 weeks | 95% (stabilized with TBC or HQ) | |
| 100g | 2 -3 weeks | 95% (stabilized with TBC or HQ) |
| Transport Condition | 2-8°C |
|---|---|
| Storage Temp. | Inert atmosphere,2-8°C |
| GHS Pictogram |  |
| Hazard category | - |
| Biological Activity | |
| Character | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H302 |
| Flash Point | |
| Safety Statements | P280-P305+P351+P338 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Warning |
|---|---|
| InchiKey | JJJFUHOGVZWXNQ-UHFFFAOYSA-N |
| Canonical Smiles | CCCCOC(=O)C(=C)C#N |
| Inchi | InChI=1S/C8H11NO2/c1-3-4-5-11-8(10)7(2)6-9/h2-5H2,1H3 |
| Density | |
| MDL No. | MFCD00134196 |
| Water Solubility | |
| Exact Mass | 153.07898 |
| Chirality | |
| GHS | |
| Cas No. | 6606-65-1 |
| Chemical Name | Butyl 2-Cyanoacrylate |
| UN No. | - |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
