Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 10g | 2 -3 weeks | 97% (stabilized with MEHQ) | |
| 25g | 2 -3 weeks | 97% (stabilized with MEHQ) | |
| 100g | 2 -3 weeks | 97% (stabilized with MEHQ) | |
| 500g | 2 -3 weeks | 97% (stabilized with MEHQ) | |
| 1kg | 2 -3 weeks | 97% (stabilized with MEHQ) |
| Transport Condition | 2-8°C |
|---|---|
| Storage Temp. | Inert atmosphere, 2-8°C |
| GHS Pictogram |  |
| Hazard category | - |
| Biological Activity | |
| Character | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H317-H335 |
| Flash Point | |
| Safety Statements | P261-P271-P272-P280-P302+P352+P333+P313+P363-P304+P340+P312-P403+P233-P405-P501 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Warning |
|---|---|
| InchiKey | STVZJERGLQHEKB-UHFFFAOYSA-N |
| Canonical Smiles | CC(=C)C(=O)OCCOC(=O)C(C)=C |
| Inchi | InChI=1S/C10H14O4/c1-7(2)9(11)13-5-6-14-10(12)8(3)4/h1,3,5-6H2,2,4H3 |
| Density | |
| MDL No. | MFCD00008590 |
| Water Solubility | |
| Exact Mass | 198.08921 |
| Chirality | |
| GHS | |
| Cas No. | 97-90-5 |
| Chemical Name | Ethylene Dimethacrylate |
| UN No. | - |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
