Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 5g | 2 -3 weeks | 95%, mixture of isomers | |
| 25g | 2 -3 weeks | 95%, mixture of isomers | |
| 100g | 2 -3 weeks | 95%, mixture of isomers | |
| 500g | 2 -3 weeks | 95%, mixture of isomers | |
| 2.5kg | 2 -3 weeks | 95%, mixture of isomers |
| Transport Condition | Store in a cool,dry area. |
|---|---|
| Storage Temp. | Store in a cool,dry area. |
| GHS Pictogram |    |
| Hazard category | 9 |
| Biological Activity | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Dangerous Goods | |
| Risk Statements | H302-H319-H372-H410 |
| Flash Point | |
| Safety Statements | P501-P273-P260-P270-P264-P280-P391-P314-P337+P313-P305+P351+P338-P301+P312+P330 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | |
|---|---|
| InchiKey | CRDAMVZIKSXKFV-YFVJMOTDSA-N |
| Canonical Smiles | CC(C)=CCC/C(/C)=C/CC/C(/C)=C/CO |
| Inchi | InChI=1S/C15H26O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,11,16H,5-6,8,10,12H2,1-4H3/b14-9+,15-11+ |
| Density | |
| MDL No. | MFCD00002918 |
| Water Solubility | |
| Exact Mass | 222.19837 |
| Chirality | |
| GHS | |
| Cas No. | 4602-84-0 |
| Chemical Name | Farnesol |
| UN No. | 3082 |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
