Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 1g | 2 weeks | 95%+ | |
| 5g | 2 weeks | 95%+ | |
| 25g | 2 weeks | 95%+ | |
| 100g | 2 weeks | 95%+ | |
| 500g | 2 weeks | 95%+ |
| Transport Condition | Store in a cool,dry area. |
|---|---|
| Storage Temp. | Store in a cool,dry area. |
| Hazard Codes | |
| Hazard category | |
| Biological Activity | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Dangerous Goods | |
| Risk Statements | H227; |
| Flash Point | |
| Safety Statements | |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | |
|---|---|
| InchiKey | GYUZHTWCNKINPY-UHFFFAOYSA-N |
| Canonical Smiles | CC1(C)CCC=C(C)C21CCC(C)O2 |
| Inchi | InChI=1S/C13H22O/c1-10-6-5-8-12(3,4)13(10)9-7-11(2)14-13/h6,11H,5,7-9H2,1-4H3 |
| Density | |
| MDL No. | MFCD00085214 |
| Water Solubility | |
| Exact Mass | 194.16707 |
| Chirality | |
| GHS | |
| Cas No. | 36431-72-8 |
| Chemical Name | Theaspirane,mixture of cis and trans |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
