Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 250mg | 2 -3 weeks | 96% | |
| 1g | 2 -3 weeks | 90% +(GC)(isomers mixture) | |
| 1g | 2 -3 weeks | 96% | |
| 5g | 2 -3 weeks | 96% | |
| 5g | 2 -3 weeks | 90% +(GC)(isomers mixture) | |
| 10g | 2 -3 weeks | 96% | |
| 25g | 2 -3 weeks | 90% +(GC)(isomers mixture) | |
| 100g | 2 -3 weeks | 90% +(GC)(isomers mixture) |
| Transport Condition | Room Temperature |
|---|---|
| Storage Temp. | Sealed in dry,Room Temperature |
| GHS Pictogram |  |
| Hazard category | - |
| Biological Activity | |
| Character | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H227-H315-H319-H335 |
| Flash Point | |
| Safety Statements | P305+P351+P338 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Warning |
|---|---|
| InchiKey | GYUZHTWCNKINPY-UHFFFAOYSA-N |
| Canonical Smiles | CC1(C)CCC=C(C)C21CCC(C)O2 |
| Inchi | InChI=1S/C13H22O/c1-10-6-5-8-12(3,4)13(10)9-7-11(2)14-13/h6,11H,5,7-9H2,1-4H3 |
| Density | |
| MDL No. | MFCD00085214 |
| Water Solubility | |
| Exact Mass | 194.16707 |
| Chirality | |
| GHS | |
| Cas No. | 36431-72-8 |
| Chemical Name | Theaspirane,mixture of cis and trans |
| UN No. | - |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
