Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 1g | 2 -3 weeks | 98% (stabilized with Copper) | |
| 5g | 2 -3 weeks | 98% (stabilized with Copper) | |
| 10g | 2 -3 weeks | 98% (stabilized with Copper) | |
| 25g | 2 -3 weeks | 98% (stabilized with Copper) | |
| 100g | 2 -3 weeks | 98% (stabilized with Copper) | |
| 500g | 2 -3 weeks | 98% (stabilized with Copper) | |
| 1kg | 2 -3 weeks | 98% (stabilized with Copper) |
| Transport Condition | Room Temperature |
|---|---|
| Storage Temp. | Keep in dark place,Inert atmosphere,Room temperature |
| GHS Pictogram |  |
| Hazard category | - |
| Biological Activity | |
| Character | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H315-H319-H335 |
| Flash Point | |
| Safety Statements | P261-P305+P351+P338 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Warning |
|---|---|
| InchiKey | OPYHNLNYCRZOGY-UHFFFAOYSA-N |
| Canonical Smiles | FC1=C(I)C(F)=C(F)C(F)=C1F |
| Inchi | InChI=1S/C6F5I/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
| Density | |
| MDL No. | MFCD00001032 |
| Water Solubility | |
| Exact Mass | 293.89648 |
| Chirality | |
| GHS | |
| Cas No. | 827-15-6 |
| Chemical Name | Iodopentafluorobenzene |
| UN No. | - |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
