Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 25g | 2 -3 weeks | 96% +(stabilized with MEHQ) | |
| 100g | 2 -3 weeks | 96% +(stabilized with MEHQ) | |
| 500g | 2 -3 weeks | 96% +(stabilized with MEHQ) | |
| 2.5kg | 2 -3 weeks | 96% +(stabilized with MEHQ) | |
| 25kg | 2 -3 weeks | 96% +(stabilized with MEHQ) |
| Transport Condition | Store in a cool,dry area. |
|---|---|
| Storage Temp. | Store in a cool,dry area. |
| GHS Pictogram |  |
| Hazard category | - |
| Biological Activity | |
| Character | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H317;H400;H303; |
| Flash Point | |
| Safety Statements | P280-P305+P351+P338 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Warning |
|---|---|
| InchiKey | PSGCQDPCAWOCSH-UHFFFAOYSA-N |
| Canonical Smiles | CC1(C)C2CC(OC(=O)C=C)C1(C)CC2 |
| Inchi | InChI=1S/C13H20O2/c1-5-11(14)15-10-8-9-6-7-13(10,4)12(9,2)3/h5,9-10H,1,6-8H2,2-4H3 |
| Density | |
| MDL No. | MFCD00080424 |
| Water Solubility | |
| Exact Mass | 208.14633 |
| Chirality | |
| GHS | |
| Cas No. | 5888-33-5 |
| Chemical Name | Isobornyl Acrylate |
| UN No. | - |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
