Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 25g | 2 weeks | 99%,mixture of cis/trans-isomers | |
| 100g | 2 weeks | 99%,mixture of cis/trans-isomers | |
| 500g | 2 weeks | 99%,mixture of cis/trans-isomers | |
| 2.5kg | 2 weeks | 99%,mixture of cis/trans-isomers | |
| 10kg | 2 weeks | 99%,mixture of cis/trans-isomers |
| Transport Condition | 2-8℃ |
|---|---|
| Storage Temp. | 2-8℃ |
| GHS Pictogram | |
| Hazard category | |
| Biological Activity | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Dangerous Goods | |
| Risk Statements | H317;H302; |
| Flash Point | |
| Safety Statements | |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | |
|---|---|
| InchiKey | BJIOGJUNALELMI-UHFFFAOYSA-N |
| Canonical Smiles | CC=CC1=CC(OC)=C(O)C=C1 |
| Inchi | InChI=1S/C10H12O2/c1-3-4-8-5-6-9(11)10(7-8)12-2/h3-7,11H,1-2H3 |
| Density | |
| MDL No. | MFCD00009285 |
| Water Solubility | |
| Exact Mass | 164.08373 |
| Chirality | |
| GHS | |
| Cas No. | 97-54-1 |
| Chemical Name | Isoeugenol |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
