Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 1g | 2 -3 weeks | 97% | |
| 5g | 2 -3 weeks | 97% | |
| 25g | 2 -3 weeks | 97% | |
| 100g | 2 -3 weeks | 97% | |
| 500g | 2 -3 weeks | 97% |
| Transport Condition | room temperature |
|---|---|
| Storage Temp. | Store at room temperature, keep dry and cool |
| GHS Pictogram |  |
| Hazard category | |
| Biological Activity | |
| Character | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H315-H319 |
| Flash Point | |
| Safety Statements | P305+P351+P338 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | |
|---|---|
| InchiKey | MUVQIIBPDFTEKM-QWWZWVQMSA-N |
| Canonical Smiles | C[C@@H](O)[C@H](N)CO |
| Inchi | InChI=1S/C4H11NO2/c1-3(7)4(5)2-6/h3-4,6-7H,2,5H2,1H3/t3-,4-/m1/s1 |
| Density | |
| MDL No. | MFCD00191173 |
| Water Solubility | |
| Exact Mass | 105.07898 |
| Chirality | |
| GHS | |
| Cas No. | 3228-51-1 |
| Chemical Name | L-Threoninol |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
