Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 1g | 2 -3 weeks | 98% (stabilized with BHT or HQ) | |
| 5g | 2 -3 weeks | 98% (stabilized with BHT or HQ) | |
| 25g | 2 -3 weeks | 98% (stabilized with BHT or HQ) |
| Transport Condition | -20℃ |
|---|---|
| Storage Temp. | -20℃ |
| GHS Pictogram |  |
| Hazard category | 8 |
| Biological Activity | |
| Character | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H318;H335;H315; |
| Flash Point | |
| Safety Statements | P210-P264-P271-P280-P301+P330+P331-P303+P361+P353-P304+P340-P305+P351+P338-P310-P363-P370+P378-P403+P233-P501 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Danger |
|---|---|
| InchiKey | CFTUQSLVERGMHL-UHFFFAOYSA-N |
| Canonical Smiles | COC(=O)C(=C)CBr |
| Inchi | InChI=1S/C5H7BrO2/c1-4(3-6)5(7)8-2/h1,3H2,2H3 |
| Density | |
| MDL No. | MFCD00011697 |
| Water Solubility | |
| Exact Mass | 177.96294 |
| Chirality | |
| GHS | |
| Cas No. | 4224-69-5 |
| Chemical Name | Methyl 2-(Bromomethyl)Acrylate |
| UN No. | 3265 |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
