2-(Dimethylamino)Ethyl Acrylate
Catalog No. :
Cas No. :
Brand :
Molecular Formula :
Molecular Weight :
| Pack Size |
Availability |
Purity |
Price |
User Price |
Quantity |
| 1g |
2 -3 weeks |
98% (stabilized with MEHQ) |
|
|
|
| 100g |
2 -3 weeks |
98% (stabilized with MEHQ) |
|
|
|
| Transport Condition |
2-8℃ |
| Storage Temp. |
2-8℃ |
| GHS Pictogram |
    |
| Hazard category |
6.1 |
| Character |
|
| Useage |
|
| Risk Statements |
H317;H330;H311;H410;H302;H400;H227;H314; |
| Safety Statements |
P210-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P370+P378 |
| Physicochemical Propertie |
|
| Signal Word |
Danger |
| InchiKey |
DPBJAVGHACCNRL-UHFFFAOYSA-N |
| Canonical Smiles |
CN(C)CCOC(=O)C=C |
| Inchi |
InChI=1S/C7H13NO2/c1-4-7(9)10-6-5-8(2)3/h4H,1,5-6H2,2-3H3 |
| MDL No. |
MFCD00038233 |
| GHS |
|
| Cas No. |
2439-35-2 |
| Chemical Name |
2-(Dimethylamino)Ethyl Acrylate |
| UN No. |
3302 |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available