Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 25g | 2 weeks | 99%,mixture of isomers | |
| 25ml | 2 weeks | 99%,mixture of isomers | |
| 100ml | 2 weeks | 99%,mixture of isomers | |
| 100g | 2 weeks | 99%,mixture of isomers | |
| 500ml | 2 weeks | 99%,mixture of isomers | |
| 500g | 2 weeks | 99%,mixture of isomers | |
| 2.5L | 2 weeks | 99%,mixture of isomers | |
| 2.5kg | 2 weeks | 99%,mixture of isomers | |
| 25kg | 2 weeks | 99%,mixture of isomers | |
| 25L | 2 weeks | 99%,mixture of isomers |
| Transport Condition | -20℃ |
|---|---|
| Storage Temp. | -20℃ |
| Hazard Codes |  |
| Hazard category | |
| Biological Activity | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Dangerous Goods | |
| Risk Statements | H315-H319-H413 |
| Flash Point | |
| Safety Statements | P264-P273-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Warning |
|---|---|
| InchiKey | QYDYPVFESGNLHU-UHFFFAOYSA-N |
| Canonical Smiles | CCCCCCCCC=CCCCCCCCC(=O)OC |
| Inchi | InChI=1S/C19H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h10-11H,3-9,12-18H2,1-2H3 |
| Density | |
| MDL No. | MFCD00009578 |
| Water Solubility | |
| Exact Mass | 296.27153 |
| Chirality | |
| GHS | |
| Cas No. | 112-62-9 |
| Chemical Name | Methyl oleate |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
