Popular keywords:
| Pack Size | Availability | Purity | Price | User Price | Quantity |
|---|---|---|---|---|---|
| 250mg | 2 -3 weeks | 96% (stabilized with MEHQ) | |||
| 1g | 2 -3 weeks | 96% (stabilized with MEHQ) | |||
| 5g | 2 -3 weeks | 96% (stabilized with MEHQ) | |||
| 25g | 2 -3 weeks | 96% (stabilized with MEHQ) |
| Transport Condition | 2-8℃ |
|---|---|
| Storage Temp. | 2-8℃ |
| GHS Pictogram |  |
| Hazard category | - |
| Biological Activity | |
| Character | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H319;H335;H315; |
| Flash Point | |
| Safety Statements | P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P321-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Warning |
|---|---|
| InchiKey | BSCJIBOZTKGXQP-UHFFFAOYSA-N |
| Canonical Smiles | CC(=C)C(=O)NCCO |
| Inchi | InChI=1S/C6H11NO2/c1-5(2)6(9)7-3-4-8/h8H,1,3-4H2,2H3,(H,7,9) |
| Density | |
| MDL No. | MFCD00080529 |
| Water Solubility | |
| Exact Mass | 129.07898 |
| Chirality | |
| GHS | |
| Cas No. | 5238-56-2 |
| Chemical Name | N-(2-Hydroxyethyl)Methacrylamide |
| UN No. | - |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Competitive Price
Delivery Speed
Technical Support
Stock Inventory
