Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 5ml | 2 -3 weeks | 98%,stabilized with 100ppm MEHQ | |
| 25ml | 2 -3 weeks | 98%,stabilized with 100ppm MEHQ | |
| 100ml | 2 -3 weeks | 98%,stabilized with 100ppm MEHQ | |
| 500ml | 2 -3 weeks | 98%,stabilized with 100ppm MEHQ | |
| 2.5L | 2 -3 weeks | 98%,stabilized with 100ppm MEHQ |
| Transport Condition | Store in a cool,dry area. |
|---|---|
| Storage Temp. | Store in a cool,dry area. |
| GHS Pictogram |  |
| Hazard category | - |
| Biological Activity | |
| Character | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H319;H335;H401;H227;H315; |
| Flash Point | |
| Safety Statements | P280-P304+P340+P312-P305+P351+P338-P333+P313-P337+P313 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Warning |
|---|---|
| InchiKey | LNCPIMCVTKXXOY-UHFFFAOYSA-N |
| Canonical Smiles | CC(=C)C(=O)OCCCCCC |
| Inchi | InChI=1S/C10H18O2/c1-4-5-6-7-8-12-10(11)9(2)3/h2,4-8H2,1,3H3 |
| Density | |
| MDL No. | MFCD00015283 |
| Water Solubility | |
| Exact Mass | 170.13068 |
| Chirality | |
| GHS | |
| Cas No. | 142-09-6 |
| Chemical Name | Hexyl Methacrylate |
| UN No. | - |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
