Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 5g | 2 -3 weeks | 97%+,stabilized with HO-TEMPO | |
| 25g | 2 -3 weeks | 97%+,stabilized with HO-TEMPO | |
| 100g | 2 -3 weeks | 97%+,stabilized with HO-TEMPO | |
| 500g | 2 -3 weeks | 97%+,stabilized with HO-TEMPO | |
| 2.5kg | 2 -3 weeks | 97%+,stabilized with HO-TEMPO | |
| 10kg | 2 -3 weeks | 97%+,stabilized with HO-TEMPO |
| Transport Condition | 2-8°C |
|---|---|
| Storage Temp. | Sealed in dry,2-8°C |
| GHS Pictogram |  |
| Hazard category | - |
| Biological Activity | |
| Character | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H302-H312-H317-H332 |
| Flash Point | |
| Safety Statements | P280 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Warning |
|---|---|
| InchiKey | JWYVGKFDLWWQJX-UHFFFAOYSA-N |
| Canonical Smiles | C=CN1CCCCCC1=O |
| Inchi | InChI=1S/C8H13NO/c1-2-9-7-5-3-4-6-8(9)10/h2H,1,3-7H2 |
| Density | |
| MDL No. | MFCD00080693 |
| Water Solubility | |
| Exact Mass | 139.09971 |
| Chirality | |
| GHS | |
| Cas No. | 2235-00-9 |
| Chemical Name | N-Vinylcaprolactam |
| UN No. | - |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
