| Transport Condition | 2-8°C, sealed storage, away from moisture and light |
|---|---|
| Storage Temp. | 2-8°C, sealed storage, away from moisture and light |
| GHS Pictogram | ![]() |
| Hazard category | - |
| Character | (Solid) |
| Useage | |
| Risk Statements | H315-H319-H335 |
| Safety Statements | P261-P305+P351+P338 |
| Physicochemical Propertie |
| Signal Word | Warning |
|---|---|
| InchiKey | MZKKJVZIFIQOPP-UHFFFAOYSA-M |
| Canonical Smiles | [K+].NC1=CC=C(C=C1)C([O-])=O |
| Inchi | InChI=1S/C7H7NO2.K/c8-6-3-1-5(2-4-6)7(9)10;/h1-4H,8H2,(H,9,10);/q;+1/p-1 |
| MDL No. | MFCD00064911 |
| GHS | |
| Cas No. | 138-84-1 |
| Chemical Name | 4-Aminobenzoic acid (potassium) |
| UN No. | - |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Competitive Price
Delivery Speed
Technical Support
Stock Inventory