Popular keywords:
| Pack Size | Availability | Purity | Price | User Price | Quantity |
|---|---|---|---|---|---|
| 25g | 2 -3 weeks | 80% GC(stabilized with MEHQ) | |||
| 100g | 2 -3 weeks | 80% GC(stabilized with MEHQ) | |||
| 500g | 2 -3 weeks | 80% GC(stabilized with MEHQ) | |||
| 1kg | 2 -3 weeks | 80% GC(stabilized with MEHQ) |
| Transport Condition | room temperature |
|---|---|
| Storage Temp. | Sealed in dry, room temperature |
| GHS Pictogram |  |
| Hazard category | - |
| Biological Activity | |
| Character | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H315-H317-H319 |
| Flash Point | |
| Safety Statements | P280-P305+P351+P338 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Warning |
|---|---|
| InchiKey | KNSXNCFKSZZHEA-UHFFFAOYSA-N |
| Canonical Smiles | C=CC(=O)OCC(COC(=O)C=C)(COC(=O)C=C)COC(=O)C=C |
| Inchi | InChI=1S/C17H20O8/c1-5-13(18)22-9-17(10-23-14(19)6-2,11-24-15(20)7-3)12-25-16(21)8-4/h5-8H,1-4,9-12H2 |
| Density | |
| MDL No. | MFCD00015334 |
| Water Solubility | |
| Exact Mass | 352.11582 |
| Chirality | |
| GHS | |
| Cas No. | 4986-89-4 |
| Chemical Name | Pentaerythritol Tetraacrylate |
| UN No. | - |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Competitive Price
Delivery Speed
Technical Support
Stock Inventory
