Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 1g | 2 -3 weeks | 97% (stabilized with BHT) | |
| 5g | 2 -3 weeks | 97% (stabilized with BHT) | |
| 10g | 2 -3 weeks | 97% (stabilized with BHT) | |
| 25g | 2 -3 weeks | 97% (stabilized with BHT) | |
| 100g | 2 -3 weeks | 97% (stabilized with BHT) | |
| 500g | 2 -3 weeks | 97% (stabilized with BHT) |
| Transport Condition | 2-8℃ |
|---|---|
| Storage Temp. | 2-8℃ |
| GHS Pictogram |    |
| Hazard category | 9 |
| Biological Activity | |
| Character | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H302-H319-H372-H410 |
| Flash Point | |
| Safety Statements | P501-P273-P260-P270-P264-P280-P391-P314-P337+P313-P305+P351+P338-P301+P312+P330 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Danger |
|---|---|
| InchiKey | WRAQQYDMVSCOTE-UHFFFAOYSA-N |
| Canonical Smiles | C=CC(=O)OC1C=CC=CC=1 |
| Inchi | InChI=1S/C9H8O2/c1-2-9(10)11-8-6-4-3-5-7-8/h2-7H,1H2 |
| Density | |
| MDL No. | MFCD00048145 |
| Water Solubility | |
| Exact Mass | 148.05243 |
| Chirality | |
| GHS | |
| Cas No. | 937-41-7 |
| Chemical Name | Phenyl Acrylate |
| UN No. | 3082 |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
