Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
|
Sorry, there is no price information yet |
|||
| Transport Condition | Room Temperature |
|---|---|
| Storage Temp. | Sealed in dry,Room Temperature |
| GHS Pictogram |  |
| Hazard category | N/A |
| Biological Activity | |
| Character | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H302 |
| Flash Point | |
| Safety Statements | P280-P305+P351+P338 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Warning |
|---|---|
| InchiKey | FWNZKPKGBYWNJO-KVVVOXFISA-N |
| Canonical Smiles | CCCCCCCC/C=C\CCCCCCCC(O)=O.CC(O)CO |
| Inchi | InChI=1S/C18H34O2.C3H8O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3(5)2-4/h9-10H,2-8,11-17H2,1H3,(H,19,20);3-5H,2H2,1H3/b10-9-; |
| Density | |
| MDL No. | MFCD00046647 |
| Water Solubility | |
| Exact Mass | 358.30831 |
| Chirality | |
| GHS | |
| Cas No. | 1330-80-9 |
| Chemical Name | Oleic acid compound with propane-1,2-diol (1:1) |
| UN No. | N/A |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
