Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
|
Sorry, there is no price information yet |
|||
| Transport Condition | -20°C |
|---|---|
| Storage Temp. | -20°C, sealed storage, away from moisture and light |
| GHS Pictogram |  |
| Hazard category | 6.1 |
| Biological Activity | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Dangerous Goods | |
| Risk Statements | H301-H311-H331 |
| Flash Point | |
| Safety Statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P310-P330-P361-P403+P233-P405-P501 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | |
|---|---|
| InchiKey | IZBOWCSSQNGKEM-UHFFFAOYSA-N |
| Canonical Smiles | COC(=O)C1C(N)=NC=NC=1Cl |
| Inchi | InChI=1S/C6H6ClN3O2/c1-12-6(11)3-4(7)9-2-10-5(3)8/h2H,1H3,(H2,8,9,10) |
| Density | |
| MDL No. | MFCD32705193 |
| Water Solubility | |
| Exact Mass | 187.01485 |
| Chirality | |
| GHS | |
| Cas No. | 2091735-99-6 |
| Chemical Name | Methyl 4-amino-6-chloropyrimidine-5-carboxylate |
| UN No. | 2811 |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
