Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 10g | 2 -3 weeks | 98% | |
| 25g | 2 -3 weeks | 98% | |
| 100g | 2 -3 weeks | 98% | |
| 500g | 2 -3 weeks | 98% | |
| 1kg | 2 -3 weeks | 98% |
| Transport Condition | room temperature |
|---|---|
| Storage Temp. | Store at room temperature, keep dry and cool |
| GHS Pictogram |   |
| Hazard category | |
| Biological Activity | |
| Character | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H302-H351-H361 |
| Flash Point | |
| Safety Statements | P280-P305+P351+P338 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | |
|---|---|
| InchiKey | WOLHOYHSEKDWQH-GFZFNSNDSA-N |
| Canonical Smiles | Cl.NC12C[C@@H]3C[C@H](C1)C[C@H](C2)C3 |
| Inchi | InChI=1S/C10H17N.ClH/c11-10-4-7-1-8(5-10)3-9(2-7)6-10;/h7-9H,1-6,11H2;1H/t7-,8+,9-,10?; |
| Density | |
| MDL No. | MFCD00074723 |
| Water Solubility | |
| Exact Mass | 187.11278 |
| Chirality | |
| GHS | |
| Cas No. | 665-66-7 |
| Chemical Name | Amantadine (hydrochloride) |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
