Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
|
Sorry, there is no price information yet |
|||
| Transport Condition | room temperature |
|---|---|
| Storage Temp. | Store at room temperature, keep dry and cool |
| GHS Pictogram |  |
| Hazard category | |
| Biological Activity | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Dangerous Goods | |
| Risk Statements | H302-H315-H319-H335 |
| Flash Point | |
| Safety Statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | |
|---|---|
| InchiKey | PQIJNAJAAMHSNW-OGFXRTJISA-N |
| Canonical Smiles | Cl.N[C@@H]1COC2=C(F)C=CC=C21 |
| Inchi | InChI=1S/C8H8FNO.ClH/c9-6-3-1-2-5-7(10)4-11-8(5)6;/h1-3,7H,4,10H2;1H/t7-;/m1./s1 |
| Density | |
| MDL No. | MFCD24435422 |
| Water Solubility | |
| Exact Mass | 189.03567 |
| Chirality | |
| GHS | |
| Cas No. | 2453296-92-7 |
| Chemical Name | (S)-7-Fluoro-2,3-dihydrobenzofuran-3-amine hydrochloride |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
