Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 1 g | 2 weeks | 98% |
| Transport Condition | room temperature |
|---|---|
| Storage Temp. | Store at room temperature, keep dry and cool |
| Hazard Codes |  |
| Hazard category | |
| Biological Activity | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Dangerous Goods | |
| Risk Statements | H315-H319-H335 |
| Flash Point | |
| Safety Statements | P261-P305+P351+P338 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | |
|---|---|
| InchiKey | FITCPYYVAJWASG-UHFFFAOYSA-N |
| Canonical Smiles | Cl.COC1=NC(=CC=C1N)OC |
| Inchi | InChI=1S/C7H10N2O2.ClH/c1-10-6-4-3-5(8)7(9-6)11-2;/h3-4H,8H2,1-2H3;1H |
| Density | |
| MDL No. | MFCD00012816 |
| Water Solubility | |
| Exact Mass | 190.05091 |
| Chirality | |
| GHS | |
| Cas No. | 80789-72-6 |
| Chemical Name | 3-Amino-2,6-dimethoxypyridine monohydrochloride |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
