| Pack Size | Availability | Purity | Price | User Price | Quantity |
|---|---|---|---|---|---|
| 100mg | 2 -3 weeks | 98% | |||
| 250mg | 2 -3 weeks | 98% | |||
| 1g | 2 -3 weeks | 98% | |||
| 5g | 2 -3 weeks | 98% |
| Transport Condition | 2-8°C |
|---|---|
| Storage Temp. | 2-8°C, protect from light |
| GHS Pictogram | ![]() |
| Hazard category | |
| Biological Activity | |
| Character | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H319 |
| Flash Point | |
| Safety Statements | P305+P351+P338 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Warning |
|---|---|
| InchiKey | OIQGECPSMWFOCC-UHFFFAOYSA-N |
| Canonical Smiles | CC1OC2C=C(N)C=CC=2N(C)C1=O |
| Inchi | InChI=1S/C10H12N2O2/c1-6-10(13)12(2)8-4-3-7(11)5-9(8)14-6/h3-6H,11H2,1-2H3 |
| Density | |
| MDL No. | MFCD09907443 |
| Water Solubility | |
| Exact Mass | 192.08988 |
| Chirality | |
| GHS | |
| Cas No. | 130137-40-5 |
| Chemical Name | 7-Amino-2,4-dimethyl-2h-benzo[b][1,4]oxazin-3(4h)-one |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
Competitive Price
Delivery Speed
Technical Support
Stock Inventory