Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 100mg | 95% with 200ppm stabilizer | ||
| 250mg | 95% with 200ppm stabilizer | ||
| 1g | 95% with 200ppm stabilizer | ||
| 5g | 95% with 200ppm stabilizer |
| Transport Condition | 2-8°C |
|---|---|
| Storage Temp. | Sealed in dry,2-8°C |
| GHS Pictogram |  |
| Hazard category | H315-H319-H335 |
| Biological Activity | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Dangerous Goods | |
| Risk Statements | - |
| Flash Point | |
| Safety Statements | P261-P305+P351+P338 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Warning |
|---|---|
| InchiKey | YBWQZBVPWXXJKQ-UHFFFAOYSA-N |
| Canonical Smiles | C=CC(=O)NCCCCO |
| Inchi | InChI=1S/C7H13NO2/c1-2-7(10)8-5-3-4-6-9/h2,9H,1,3-6H2,(H,8,10) |
| Density | |
| MDL No. | MFCD29919236 |
| Water Solubility | |
| Exact Mass | 143.09463 |
| Chirality | |
| GHS | |
| Cas No. | 44915-40-4 |
| Chemical Name | N-(4-Hydroxybutyl)acrylamide |
| UN No. | - |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
