Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 250mg | 2 -3 weeks | 98% | |
| 1g | 2 -3 weeks | 98% | |
| 5g | 2 -3 weeks | 98% |
| Transport Condition | Room temperature |
|---|---|
| Storage Temp. | Keep in dark place,Inert atmosphere,Room temperature |
| GHS Pictogram |  |
| Hazard category | 8 |
| Biological Activity | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Dangerous Goods | |
| Risk Statements | H314 |
| Flash Point | |
| Safety Statements | P260-P264-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P405-P501 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Danger |
|---|---|
| InchiKey | FNHBFOVJIPXNFL-UHFFFAOYSA-N |
| Canonical Smiles | NCCC1CCC(O)CC1 |
| Inchi | InChI=1S/C8H17NO/c9-6-5-7-1-3-8(10)4-2-7/h7-8,10H,1-6,9H2 |
| Density | |
| MDL No. | MFCD11520548 |
| Water Solubility | |
| Exact Mass | 143.13101 |
| Chirality | |
| GHS | |
| Cas No. | 148356-06-3 |
| Chemical Name | 4-(2-Aminoethyl)cyclohexanol (cis- and trans- mixture) |
| UN No. | 2735 |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
