Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 1g | 98+% |
| Transport Condition | - |
|---|---|
| Storage Temp. | - |
| GHS Pictogram |  |
| Hazard category | H301+H311-H410 |
| Biological Activity | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Dangerous Goods | |
| Risk Statements | 6.1 |
| Flash Point | |
| Safety Statements | P264-P270-P273-P280-P301+P310+P330-P302+P352+P312-P362-P391-P405-P501 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Danger |
|---|---|
| InchiKey | ICTQUFQQEYSGGJ-UHFFFAOYSA-N |
| Canonical Smiles | CN(C)C1CSSSC1.OC(=O)C(O)=O |
| Inchi | InChI=1S/C5H11NS3.C2H2O4/c1-6(2)5-3-7-9-8-4-5;3-1(4)2(5)6/h5H,3-4H2,1-2H3;(H,3,4)(H,5,6) |
| Density | |
| MDL No. | MFCD00211369 |
| Water Solubility | |
| Exact Mass | 271.00067 |
| Chirality | |
| GHS | |
| Cas No. | 31895-22-4 |
| Chemical Name | Oxalic acid compound with cyclohexylsulfamothioic O-acid (1:1) |
| UN No. | 2811 |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
