| Pack Size | Availability | Purity | Price | User Price | Quantity |
|---|---|---|---|---|---|
| 100mg | 2 -3 weeks | 95% (stabilized with TBC) | |||
| 250mg | 2 -3 weeks | 95% (stabilized with TBC) | |||
| 1g | 2 -3 weeks | 95% (stabilized with TBC) |
| Transport Condition | - |
|---|---|
| Storage Temp. | - |
| GHS Pictogram | |
| Hazard category | - |
| Biological Activity | |
| Character | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | - |
| Flash Point | |
| Safety Statements | - |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | - |
|---|---|
| InchiKey | LIQJLTLJINLIAF-UHFFFAOYSA-N |
| Canonical Smiles | CCOC(=O)C(N)CCC=C |
| Inchi | InChI=1S/C8H15NO2/c1-3-5-6-7(9)8(10)11-4-2/h3,7H,1,4-6,9H2,2H3 |
| Density | |
| MDL No. | MFCD18910143 |
| Water Solubility | |
| Exact Mass | 157.11028 |
| Chirality | |
| GHS | |
| Cas No. | 360059-80-9 |
| Chemical Name | Ethyl 2-aminohex-5-enoate |
| UN No. | - |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Competitive Price
Delivery Speed
Technical Support
Stock Inventory