Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 25g | 2 -3 weeks | 97% (stabilized with KOH) |
| Transport Condition | 2-8°C |
|---|---|
| Storage Temp. | Keep in dark place,Inert atmosphere,2-8°C |
| GHS Pictogram |  |
| Hazard category | 3(8) |
| Biological Activity | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | P210-P235-P240-P241-P242-P243-P260-P264-P280-P301+P330+P331-P303+P361+P353-P304+P340-P305+P351+P338-P310-P321-P363-P370+P378-P403+P235-P405-P501 |
| Dangerous Goods | |
| Risk Statements | H225-H314 |
| Flash Point | |
| Safety Statements | |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Danger |
|---|---|
| InchiKey | MUMVIYLVHVCYGI-UHFFFAOYSA-N |
| Canonical Smiles | CN(C)C(N(C)C)N(C)C |
| Inchi | InChI=1S/C7H19N3/c1-8(2)7(9(3)4)10(5)6/h7H,1-6H3 |
| Density | |
| MDL No. | MFCD00008322 |
| Water Solubility | |
| Exact Mass | 145.15790 |
| Chirality | |
| GHS | |
| Cas No. | 5762-56-1 |
| Chemical Name | Tris(dimethylamino)methane |
| UN No. | 2733 |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
