Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 1g | 95+% |
| Transport Condition | 2-8°C |
|---|---|
| Storage Temp. | Sealed in dry,2-8°C |
| GHS Pictogram | |
| Hazard category | - |
| Biological Activity | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Dangerous Goods | |
| Risk Statements | - |
| Flash Point | |
| Safety Statements | - |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | - |
|---|---|
| InchiKey | NRFTYXPBPGGKHT-UHFFFAOYSA-N |
| Canonical Smiles | CC1=CC=CC=C1O.NC1C=CC(=CC=1)C1C=CC(N)=CC=1 |
| Inchi | InChI=1S/C12H12N2.C7H8O/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;1-6-4-2-3-5-7(6)8/h1-8H,13-14H2;2-5,8H,1H3 |
| Density | |
| MDL No. | - |
| Water Solubility | |
| Exact Mass | 292.15756 |
| Chirality | |
| GHS | |
| Cas No. | 116030-76-3 |
| Chemical Name | Benzidine compound with o-cresol (1:1) |
| UN No. | - |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
