| Transport Condition | Store at room temperature, keep dry and cool |
|---|---|
| Storage Temp. | Store at room temperature, keep dry and cool |
| GHS Pictogram | ![]() |
| Hazard category | |
| Character | |
| Useage | |
| Risk Statements | H302-H315-H319-H335 |
| Safety Statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P305+P351+P338-P330-P362+P364-P403+P233-P405-P501 |
| Physicochemical Propertie |
| Signal Word | Warning |
|---|---|
| InchiKey | DAXIRROPQUKVEZ-GPKQSYPGSA-N |
| Canonical Smiles | Cl.CC1C(C#N)=C(F)C=CC=1[C@H]1CN2CCNC[C@@H]2CO1 |
| Inchi | InChI=1S/C15H18FN3O.ClH/c1-10-12(2-3-14(16)13(10)6-17)15-8-19-5-4-18-7-11(19)9-20-15;/h2-3,11,15,18H,4-5,7-9H2,1H3;1H/t11-,15-;/m1./s1 |
| MDL No. | 0 |
| GHS | |
| Cas No. | 1443739-29-4 |
| Chemical Name | 6-Fluoro-2-methyl-3-((3S,9aR)-octahydropyrazino[2,1-c][1,4]oxazin-3-yl)benzonitrile hydrochloride |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Competitive Price
Delivery Speed
Technical Support
Stock Inventory