1-Phenylethane-1,2-diamine dihydrochloride
Catalog No. :
Cas No. :
Brand :
Molecular Formula :
Molecular Weight :
| Pack Size |
Availability |
Purity |
Price |
User Price |
Quantity |
| 100mg |
2 -3 weeks |
98% |
|
|
|
| 250mg |
2 -3 weeks |
98% |
|
|
|
| 1g |
2 -3 weeks |
98% |
|
|
|
| Transport Condition |
Store at room temperature, keep dry and cool |
| Storage Temp. |
Store at room temperature, keep dry and cool |
| GHS Pictogram |
 |
| Hazard category |
|
| Character |
white(Solid) |
| Useage |
|
| Risk Statements |
H302-H315-H319-H335 |
| Safety Statements |
P261-P264-P270-P271-P280-P302+P352-P304+P340-P330-P362+P364-P405-P501 |
| Physicochemical Propertie |
|
| Signal Word |
Warning |
| InchiKey |
ZVHIGOVJILOQNV-UHFFFAOYSA-N |
| Canonical Smiles |
Cl.Cl.NCC(N)C1C=CC=CC=1 |
| Inchi |
InChI=1S/C8H12N2.2ClH/c9-6-8(10)7-4-2-1-3-5-7;;/h1-5,8H,6,9-10H2;2*1H |
| MDL No. |
MFCD01726798 |
| GHS |
|
| Cas No. |
16635-94-2 |
| Chemical Name |
1-Phenylethane-1,2-diamine dihydrochloride |
| UN No. |
|
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available