| Transport Condition | Store at room temperature, keep dry and cool |
|---|---|
| Storage Temp. | Store at room temperature, keep dry and cool |
| GHS Pictogram | ![]() |
| Hazard category | |
| Character | (Solid) |
| Useage | |
| Risk Statements | H302-H315-H319-H335 |
| Safety Statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P330-P362+P364-P405-P501 |
| Physicochemical Propertie |
| Signal Word | Warning |
|---|---|
| InchiKey | ZHCFNCOCOQQZCY-UHFFFAOYSA-N |
| Canonical Smiles | Cl.OC(=O)C1(F)CNCC1C1C=CC=CC=1 |
| Inchi | InChI=1S/C11H12FNO2.ClH/c12-11(10(14)15)7-13-6-9(11)8-4-2-1-3-5-8;/h1-5,9,13H,6-7H2,(H,14,15);1H |
| MDL No. | MFCD28968298 |
| GHS | |
| Cas No. | 1803585-32-1 |
| Chemical Name | 3-Fluoro-4-phenylpyrrolidine-3-carboxylic acid (hydrochloride) |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Competitive Price
Delivery Speed
Technical Support
Stock Inventory