| Pack Size | Availability | Purity | Price | User Price | Quantity |
|---|---|---|---|---|---|
| 5mg | 2 -3 weeks | 98% | |||
| 25mg | 2 -3 weeks | 98% |
| Transport Condition | polypeptide, sealed storage, away from moisture and light |
|---|---|
| Storage Temp. | polypeptide, sealed storage, away from moisture and light |
| GHS Pictogram | ![]() |
| Hazard category | |
| Character | (Solid) |
| Useage | |
| Risk Statements | H302-H315-H319-H335 |
| Safety Statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P305+P351+P338-P330-P362+P364-P403+P233-P405-P501 |
| Physicochemical Propertie |
| Signal Word | Warning |
|---|---|
| InchiKey | YXEIIOVAGGAMCZ-NYMCBPKFSA-N |
| Canonical Smiles | CC(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CCC(O)=O)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC(O)=O)C(=O)NC1C=CC(=CC=1)[N+]([O-])=O |
| Inchi | InChI=1S/C28H38N6O11/c1-4-15(2)24(29-16(3)35)27(42)31-19(11-12-22(36)37)28(43)33-13-5-6-21(33)26(41)32-20(14-23(38)39)25(40)30-17-7-9-18(10-8-17)34(44)45/h7-10,15,19-21,24H,4-6,11-14H2,1-3H3,(H,29,35)(H,30,40)(H,31,42)(H,32,41)(H,36,37)(H,38,39)/t15-,19-,20-,21-,24-/m0/s1 |
| MDL No. | MFCD02259221 |
| GHS | |
| Cas No. | 216757-29-8 |
| Chemical Name | N-Acetyl-Ile-Glu-Pro-Asp-p-nitroanilide |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Competitive Price
Delivery Speed
Technical Support
Stock Inventory