| Pack Size | Availability | Purity | Price | User Price | Quantity |
|---|---|---|---|---|---|
| 1g | 2 -3 weeks | 95% | |||
| 5g | 2 -3 weeks | 95% | |||
| 10g | 2 -3 weeks | 95% |
| Transport Condition | RT, sealed storage, away from moisture and light |
|---|---|
| Storage Temp. | RT, sealed storage, away from moisture and light |
| GHS Pictogram | ![]() |
| Hazard category | |
| Character | yellow(Powder) |
| Useage | |
| Risk Statements | H302-H315-H319-H335 |
| Safety Statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P330-P362+P364-P405-P501 |
| Physicochemical Propertie |
| Signal Word | Warning |
|---|---|
| InchiKey | ZQMILQKSSFGVCI-UHFFFAOYSA-N |
| Canonical Smiles | Cl.Cl.CC1C=C(CN)N=CC=1 |
| Inchi | InChI=1S/C7H10N2.2ClH/c1-6-2-3-9-7(4-6)5-8;;/h2-4H,5,8H2,1H3;2*1H |
| MDL No. | MFCD22209854 |
| GHS | |
| Cas No. | 357287-88-8 |
| Chemical Name | 1-(4-Methylpyridin-2-yl)methylamine dihydrochloride |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
Competitive Price
Delivery Speed
Technical Support
Stock Inventory