3-Hydroxypropanoic acid(contains varying amounts of 3,3'-Oxydipropionic Acid) (ca. 30% in Water),ca. 30% in water
Catalog No. :
Cas No. :
Brand :
Molecular Formula :
Molecular Weight :
| Pack Size |
Availability |
Purity |
Price |
User Price |
Quantity |
| 5g |
2 -3 weeks |
ca. 30% in water |
|
|
|
| 10g |
2 -3 weeks |
ca. 30% in water |
|
|
|
| 25g |
2 -3 weeks |
ca. 30% in water |
|
|
|
| 100g |
2 -3 weeks |
ca. 30% in water |
|
|
|
| Transport Condition |
2-8°C |
| Storage Temp. |
2-8°C |
| GHS Pictogram |
 |
| Hazard category |
|
| Character |
colorless(Liquid) |
| Useage |
|
| Risk Statements |
H302-H315-H319-H335 |
| Safety Statements |
P261-P264-P270-P271-P280-P302+P352-P304+P340-P305+P351+P338-P330-P362+P364-P403+P233-P405-P501 |
| Physicochemical Propertie |
|
| Signal Word |
Warning |
| InchiKey |
ALRHLSYJTWAHJZ-UHFFFAOYSA-N |
| Canonical Smiles |
OCCC(O)=O |
| Inchi |
InChI=1S/C3H6O3/c4-2-1-3(5)6/h4H,1-2H2,(H,5,6) |
| MDL No. |
MFCD00058998 |
| GHS |
|
| Cas No. |
503-66-2 |
| Chemical Name |
3-Hydroxypropanoic acid(contains varying amounts of 3,3'-Oxydipropionic Acid) (ca. 30% in Water),ca. 30% in water |
| UN No. |
|
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available