| Transport Condition | Store at room temperature, keep dry and cool |
|---|---|
| Storage Temp. | Store at room temperature, keep dry and cool |
| GHS Pictogram | ![]() |
| Hazard category | |
| Character | white(Solid) |
| Useage | |
| Risk Statements | H315-H319-H335 |
| Safety Statements | P261-P264-P271-P280-P302+P352-P304+P340-P362+P364-P405-P501 |
| Physicochemical Propertie |
| Signal Word | Warning |
|---|---|
| InchiKey | XVCCOEWNFXXUEV-UHFFFAOYSA-N |
| Canonical Smiles | Cl.OC(=O)CC1C=NC=CC=1 |
| Inchi | InChI=1S/C7H7NO2.ClH/c9-7(10)4-6-2-1-3-8-5-6;/h1-3,5H,4H2,(H,9,10);1H |
| MDL No. | MFCD00012819 |
| GHS | |
| Cas No. | 6419-36-9 |
| Chemical Name | 3-Pyridylacetic acid (hydrochloride) |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
Competitive Price
Delivery Speed
Technical Support
Stock Inventory