| Transport Condition | Store at room temperature, keep dry and cool |
|---|---|
| Storage Temp. | Store at room temperature, keep dry and cool |
| GHS Pictogram | ![]() |
| Hazard category | |
| Character | white(Solid) |
| Useage | |
| Risk Statements | H302-H315-H319-H335 |
| Safety Statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P330-P362+P364-P405-P501 |
| Physicochemical Propertie |
| Signal Word | Warning |
|---|---|
| InchiKey | RBMGJIZCEWRQES-UHFFFAOYSA-N |
| Canonical Smiles | O.NC(=O)CC(N)C(O)=O |
| Inchi | InChI=1S/C4H8N2O3.H2O/c5-2(4(8)9)1-3(6)7;/h2H,1,5H2,(H2,6,7)(H,8,9);1H2 |
| MDL No. | MFCD00151039 |
| GHS | |
| Cas No. | 69833-18-7 |
| Chemical Name | 2,4-Diamino-4-oxobutanoic acid hydrate |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
Competitive Price
Delivery Speed
Technical Support
Stock Inventory