Popular keywords:
| Pack Size | Availability | Purity | Price | User Price | Quantity |
|---|---|---|---|---|---|
|
Sorry, there is no price information yet |
|||||
| Transport Condition | Store at room temperature, keep dry and cool |
|---|---|
| Storage Temp. | Store at room temperature, keep dry and cool |
| GHS Pictogram |  |
| Hazard category | |
| Biological Activity | |
| Character | off-white(Solid) |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H315-H319-H335 |
| Flash Point | |
| Safety Statements | P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P362+P364-P403+P233-P405-P501 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Warning |
|---|---|
| InchiKey | KMLPHLNDTVQLOJ-UHFFFAOYSA-N |
| Canonical Smiles | O.[Ca].CCCC(O)=O |
| Inchi | InChI=1S/C4H8O2.Ca.H2O/c1-2-3-4(5)6;;/h2-3H2,1H3,(H,5,6);;1H2 |
| Density | |
| MDL No. | 0 |
| Water Solubility | |
| Exact Mass | 146.02559 |
| Chirality | |
| GHS | |
| Cas No. | 99283-81-5 |
| Chemical Name | Butyric acid, calcium salt hydrate |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Competitive Price
Delivery Speed
Technical Support
Stock Inventory
