(R)-1,1-Diphenylpropan-2-amine hydrochloride
Catalog No. :
Cas No. :
Brand :
Molecular Formula :
Molecular Weight :
| Pack Size |
Availability |
Purity |
Price |
User Price |
Quantity |
| 100mg |
2 -3 weeks |
97% |
|
|
|
| 250mg |
2 -3 weeks |
97% |
|
|
|
| 1g |
2 -3 weeks |
97% |
|
|
|
| 5g |
2 -3 weeks |
97% |
|
|
|
| 10g |
2 -3 weeks |
97% |
|
|
|
| Transport Condition |
Store at room temperature, keep dry and cool |
| Storage Temp. |
Store at room temperature, keep dry and cool |
| GHS Pictogram |
 |
| Hazard category |
|
| Character |
white(Solid) |
| Useage |
|
| Risk Statements |
H302-H315-H319-H335 |
| Safety Statements |
P261-P264-P270-P271-P280-P302+P352-P304+P340-P305+P351+P338-P330-P362+P364-P403+P233-P405-P501 |
| Physicochemical Propertie |
|
| Signal Word |
Warning |
| InchiKey |
AKFNBTNILUNXAL-UTONKHPSSA-N |
| Canonical Smiles |
Cl.C[C@@H](N)C(C1=CC=CC=C1)C1=CC=CC=C1 |
| Inchi |
InChI=1S/C15H17N.ClH/c1-12(16)15(13-8-4-2-5-9-13)14-10-6-3-7-11-14;/h2-12,15H,16H2,1H3;1H/t12-;/m1./s1 |
| MDL No. |
0 |
| GHS |
|
| Cas No. |
|
| Chemical Name |
(R)-1,1-Diphenylpropan-2-amine hydrochloride |
| UN No. |
|
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available