6-Methyl-2-(1-phenylvinyl)-1,3,6,2-dioxazaborocane,95%(stabilized with TBC)
Catalog No. :
Cas No. :
Brand :
Molecular Formula :
Molecular Weight :
| Pack Size |
Availability |
Purity |
Price |
User Price |
Quantity |
| 100mg |
2 -3 weeks |
95%(stabilized with TBC) |
|
|
|
| 250mg |
2 -3 weeks |
95%(stabilized with TBC) |
|
|
|
| 1g |
2 -3 weeks |
95%(stabilized with TBC) |
|
|
|
| Transport Condition |
2-8°C |
| Storage Temp. |
2-8°C, protect from light, stored under nitrogen |
| GHS Pictogram |
 |
| Hazard category |
|
| Character |
light yellow (Solid) |
| Useage |
|
| Risk Statements |
H302-H315-H319 |
| Safety Statements |
P264-P270-P280-P302+P352-P330-P362+P364-P501 |
| Physicochemical Propertie |
|
| Signal Word |
Warning |
| InchiKey |
QWPFMUGPSYWPFD-UHFFFAOYSA-N |
| Canonical Smiles |
CN1CCOB(OCC1)C(=C)C1C=CC=CC=1 |
| Inchi |
InChI=1S/C13H18BNO2/c1-12(13-6-4-3-5-7-13)14-16-10-8-15(2)9-11-17-14/h3-7H,1,8-11H2,2H3 |
| MDL No. |
MFCD11855839 |
| GHS |
|
| Cas No. |
1150114-41-2 |
| Chemical Name |
6-Methyl-2-(1-phenylvinyl)-1,3,6,2-dioxazaborocane,95%(stabilized with TBC) |
| UN No. |
|
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available