7-Phenylhept-1-en-6-yn-3-ol,98% (stabilized with MEHQ)
Catalog No. :
Cas No. :
Brand :
Molecular Formula :
Molecular Weight :
| Pack Size |
Availability |
Purity |
Price |
User Price |
Quantity |
| 100mg |
2 -3 weeks |
98% (stabilized with MEHQ) |
|
|
|
| 250mg |
2 -3 weeks |
98% (stabilized with MEHQ) |
|
|
|
| 1g |
2 -3 weeks |
98% (stabilized with MEHQ) |
|
|
|
| Transport Condition |
2-8°C |
| Storage Temp. |
2-8°C, stored under nitrogen |
| GHS Pictogram |
 |
| Hazard category |
N/A |
| Character |
light yellow(Liquid) |
| Useage |
|
| Risk Statements |
H302-H315-H319-H335 |
| Safety Statements |
P261-P264-P270-P271-P280-P302+P352-P304+P340-P330-P362+P364-P405-P501 |
| Physicochemical Propertie |
|
| Signal Word |
Warning |
| InchiKey |
FKKBVTATPMSDGM-UHFFFAOYSA-N |
| Canonical Smiles |
C=CC(O)CCC#CC1C=CC=CC=1 |
| Inchi |
InChI=1S/C13H14O/c1-2-13(14)11-7-6-10-12-8-4-3-5-9-12/h2-5,8-9,13-14H,1,7,11H2 |
| MDL No. |
|
| GHS |
|
| Cas No. |
1276664-16-4 |
| Chemical Name |
7-Phenylhept-1-en-6-yn-3-ol,98% (stabilized with MEHQ) |
| UN No. |
N/A |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available