1-Phenylbut-3-en-1-ol,98% (stabilized with MEHQ)
Catalog No. :
Cas No. :
Brand :
Molecular Formula :
Molecular Weight :
| Pack Size |
Availability |
Purity |
Price |
User Price |
Quantity |
| 1g |
2 -3 weeks |
97% (stabilized with MEHQ) |
|
|
|
| 5g |
2 -3 weeks |
97% (stabilized with MEHQ) |
|
|
|
| 10g |
2 -3 weeks |
97% (stabilized with MEHQ) |
|
|
|
| 25g |
2 -3 weeks |
97% (stabilized with MEHQ) |
|
|
|
| 100g |
2 -3 weeks |
97% (stabilized with MEHQ) |
|
|
|
| Transport Condition |
2-8°C |
| Storage Temp. |
2-8°C, stored under nitrogen |
| GHS Pictogram |
 |
| Hazard category |
N/A |
| Character |
colorless(Liquid) |
| Useage |
|
| Risk Statements |
H302 |
| Safety Statements |
P264-P270-P330-P501 |
| Physicochemical Propertie |
|
| Signal Word |
Warning |
| InchiKey |
RGKVZBXSJFAZRE-UHFFFAOYSA-N |
| Canonical Smiles |
C=CCC(O)C1C=CC=CC=1 |
| Inchi |
InChI=1S/C10H12O/c1-2-6-10(11)9-7-4-3-5-8-9/h2-5,7-8,10-11H,1,6H2 |
| MDL No. |
MFCD00039617 |
| GHS |
|
| Cas No. |
936-58-3 |
| Chemical Name |
1-Phenylbut-3-en-1-ol,98% (stabilized with MEHQ) |
| UN No. |
N/A |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available